C16H23ClN4O3S — CID 137077497
N-[2-(aminomethyl)cyclopentyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide;hydrochloride (PubChem CID 137077497) has the molecular formula C16H23ClN4O3S and a molecular weight of 386.91 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 137077497 |
| Molecular Formula | C16H23ClN4O3S |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide;hydrochloride |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CCCC1CN.Cl |
| InChI | InChI=1S/C16H22N4O3S.ClH/c1-10(16(21)19-13-7-4-5-11(13)9-17)18-15-12-6-2-3-8-14(12)24(22,23)20-15;/h2-3,6,8,10-11,13H,4-5,7,9,17H2,1H3,(H,18,20)(H,19,21);1H |
| InChIKey | JNCVCBAVJAFGIJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|