C15H19N3O3S — CID 135767975
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-piperidin-1-ylpropan-1-one (PubChem CID 135767975) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-piperidin-1-ylpropan-1-one.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 135767975 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-piperidin-1-ylpropan-1-one |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H19N3O3S/c1-11(15(19)18-9-5-2-6-10-18)16-14-12-7-3-4-8-13(12)22(20,21)17-14/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | WLNUTCUOZHWLRY-NSHDSACASA-N |
| XLogP | 1.13 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|