C16H19N3O5S — CID 136948098
1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]piperidine-2-carboxylic acid (PubChem CID 136948098) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 136948098 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]piperidine-2-carboxylic acid |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C16H19N3O5S/c1-10(15(20)19-9-5-4-7-12(19)16(21)22)17-14-11-6-2-3-8-13(11)25(23,24)18-14/h2-3,6,8,10,12H,4-5,7,9H2,1H3,(H,17,18)(H,21,22) |
| InChIKey | PPVQMHCKVGYAAS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|