C19H22N4O3S2 — CID 135680039
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one (PubChem CID 135680039) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 135680039 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C19H22N4O3S2/c1-14(20-18-16-6-2-3-7-17(16)28(25,26)21-18)19(24)23-10-8-22(9-11-23)13-15-5-4-12-27-15/h2-7,12,14H,8-11,13H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | NQYLHRASEHCAIE-AWEZNQCLSA-N |
| XLogP | 1.52 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|