C15H20N4O3S — CID 137064281
1-[3-(aminomethyl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one (PubChem CID 137064281) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one.
| Compound Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one |
|---|---|
| PubChem CID | 137064281 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCC(CN)C1 |
| InChI | InChI=1S/C15H20N4O3S/c1-10(15(20)19-7-6-11(8-16)9-19)17-14-12-4-2-3-5-13(12)23(21,22)18-14/h2-5,10-11H,6-9,16H2,1H3,(H,17,18) |
| InChIKey | ZNYIPFUFAJHUHC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|