C17H24N4O3S — CID 137098157
1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentan-1-one (PubChem CID 137098157) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentan-1-one.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 137098157 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentan-1-one |
| SMILES | CC(C)CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CC[C@@H](N)C1 |
| InChI | InChI=1S/C17H24N4O3S/c1-11(2)9-14(17(22)21-8-7-12(18)10-21)19-16-13-5-3-4-6-15(13)25(23,24)20-16/h3-6,11-12,14H,7-10,18H2,1-2H3,(H,19,20)/t12-,14?/m1/s1 |
| InChIKey | JSRYULVLGIJIJZ-PUODRLBUSA-N |
| XLogP | 0.70 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|