C20H29N3O3S — CID 136933022
N-cyclohexyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,4-dimethylpentanamide (PubChem CID 136933022) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,4-dimethylpentanamide.
| Compound Name | N-cyclohexyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 136933022 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-cyclohexyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N,4-dimethylpentanamide |
| SMILES | CC(C)CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C20H29N3O3S/c1-14(2)13-17(20(24)23(3)15-9-5-4-6-10-15)21-19-16-11-7-8-12-18(16)27(25,26)22-19/h7-8,11-12,14-15,17H,4-6,9-10,13H2,1-3H3,(H,21,22) |
| InChIKey | NHWWYYKNAFRYSS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|