C14H17N3O5S — CID 135597948
(2-amino-2-oxoethyl) (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate (PubChem CID 135597948) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate.
| Compound Name | (2-amino-2-oxoethyl) (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 135597948 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2-amino-2-oxoethyl) (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(N)=O |
| InChI | InChI=1S/C14H17N3O5S/c1-8(2)12(14(19)22-7-11(15)18)16-13-9-5-3-4-6-10(9)23(20,21)17-13/h3-6,8,12H,7H2,1-2H3,(H2,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | VRKDCTONKIDGAP-LBPRGKRZSA-N |
| XLogP | -0.22 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|