C25H32N4O3S — CID 135975865
(2S,3S)-N-[4-(cyclohexylamino)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide (PubChem CID 135975865) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is (2S,3S)-N-[4-(cyclohexylamino)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide.
| Compound Name | (2S,3S)-N-[4-(cyclohexylamino)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 135975865 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (2S,3S)-N-[4-(cyclohexylamino)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(NC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c1-3-17(2)23(28-24-21-11-7-8-12-22(21)33(31,32)29-24)25(30)27-20-15-13-19(14-16-20)26-18-9-5-4-6-10-18/h7-8,11-18,23,26H,3-6,9-10H2,1-2H3,(H,27,30)(H,28,29)/t17-,23-/m0/s1 |
| InChIKey | MLSZODNTHLLMOZ-SBUREZEXSA-N |
| XLogP | 4.52 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|