C19H25N3O5S — CID 135798303
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate (PubChem CID 135798303) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 135798303 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)[C@@H](C)CC |
| InChI | InChI=1S/C19H25N3O5S/c1-5-11-20-18(23)13(4)27-19(24)16(12(3)6-2)21-17-14-9-7-8-10-15(14)28(25,26)22-17/h5,7-10,12-13,16H,1,6,11H2,2-4H3,(H,20,23)(H,21,22)/t12-,13+,16-/m0/s1 |
| InChIKey | AYWXUSFQNLJRDP-ZENOOKHLSA-N |
| XLogP | 1.37 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|