C18H20N4O5S3 — CID 135535604
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one (PubChem CID 135535604) has the molecular formula C18H20N4O5S3 and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 135535604 |
| Molecular Formula | C18H20N4O5S3 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H20N4O5S3/c1-13(19-17-14-5-2-3-6-15(14)29(24,25)20-17)18(23)21-8-10-22(11-9-21)30(26,27)16-7-4-12-28-16/h2-7,12-13H,8-11H2,1H3,(H,19,20) |
| InChIKey | KDMVMLBHBBHKRL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|