C13H12N2O2S2 — CID 135665519
1,1-dioxo-N-(1-thiophen-2-ylethyl)-1,2-benzothiazol-3-imine (PubChem CID 135665519) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1,1-dioxo-N-(1-thiophen-2-ylethyl)-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-(1-thiophen-2-ylethyl)-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135665519 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1,1-dioxo-N-(1-thiophen-2-ylethyl)-1,2-benzothiazol-3-imine |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)c1cccs1 |
| InChI | InChI=1S/C13H12N2O2S2/c1-9(11-6-4-8-18-11)14-13-10-5-2-3-7-12(10)19(16,17)15-13/h2-9H,1H3,(H,14,15) |
| InChIKey | PFSPTQDXCXNLMM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|