C14H13N3O2S — CID 135893857
1,1-dioxo-N-(1-pyridin-4-ylethyl)-1,2-benzothiazol-3-imine (PubChem CID 135893857) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1,1-dioxo-N-(1-pyridin-4-ylethyl)-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-(1-pyridin-4-ylethyl)-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135893857 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1,1-dioxo-N-(1-pyridin-4-ylethyl)-1,2-benzothiazol-3-imine |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)c1ccncc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-10(11-6-8-15-9-7-11)16-14-12-4-2-3-5-13(12)20(18,19)17-14/h2-10H,1H3,(H,16,17) |
| InChIKey | FDGHLXMTHKKZPP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|