C14H14N4O2S — CID 135506104
1,1-dioxo-N-(1-phenylethyl)-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine (PubChem CID 135506104) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 1,1-dioxo-N-(1-phenylethyl)-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine.
| Compound Name | 1,1-dioxo-N-(1-phenylethyl)-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine |
|---|---|
| PubChem CID | 135506104 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1,1-dioxo-N-(1-phenylethyl)-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine |
| SMILES | CC(/N=C1\Nc2ncccc2S(=O)(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-10(11-6-3-2-4-7-11)16-14-17-13-12(8-5-9-15-13)21(19,20)18-14/h2-10H,1H3,(H2,15,16,17,18) |
| InChIKey | KVIYJNLHLWZSDA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|