C14H13ClN4O2S — CID 135845260
6-chloro-1,1-dioxo-N-(1-pyridin-2-ylethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135845260) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-N-(1-pyridin-2-ylethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 6-chloro-1,1-dioxo-N-(1-pyridin-2-ylethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135845260 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 6-chloro-1,1-dioxo-N-(1-pyridin-2-ylethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(/N=C1\Nc2cc(Cl)ccc2S(=O)(=O)N1)c1ccccn1 |
| InChI | InChI=1S/C14H13ClN4O2S/c1-9(11-4-2-3-7-16-11)17-14-18-12-8-10(15)5-6-13(12)22(20,21)19-14/h2-9H,1H3,(H2,17,18,19) |
| InChIKey | WDFIDXTWFKEWAH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|