C19H14F2N4O2S — CID 155256312
5-(3,5-difluorophenyl)-1,1-dioxo-N-(pyridin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256312) has the molecular formula C19H14F2N4O2S and a molecular weight of 400.41 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-1,1-dioxo-N-(pyridin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(3,5-difluorophenyl)-1,1-dioxo-N-(pyridin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256312 |
| Molecular Formula | C19H14F2N4O2S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 5-(3,5-difluorophenyl)-1,1-dioxo-N-(pyridin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\Cc2ccccn2)Nc2c(-c3cc(F)cc(F)c3)cccc21 |
| InChI | InChI=1S/C19H14F2N4O2S/c20-13-8-12(9-14(21)10-13)16-5-3-6-17-18(16)24-19(25-28(17,26)27)23-11-15-4-1-2-7-22-15/h1-10H,11H2,(H2,23,24,25) |
| InChIKey | CVWPFIIILMXFRD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|