C13H10F2N4O2S — CID 135845302
6,8-difluoro-1,1-dioxo-N-(pyridin-3-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135845302) has the molecular formula C13H10F2N4O2S and a molecular weight of 324.31 g/mol. Its IUPAC name is 6,8-difluoro-1,1-dioxo-N-(pyridin-3-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 6,8-difluoro-1,1-dioxo-N-(pyridin-3-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135845302 |
| Molecular Formula | C13H10F2N4O2S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 6,8-difluoro-1,1-dioxo-N-(pyridin-3-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N/Cc2cccnc2)Nc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C13H10F2N4O2S/c14-9-4-10(15)12-11(5-9)18-13(19-22(12,20)21)17-7-8-2-1-3-16-6-8/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | QTIFZKLPJJQMEU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|