C12H11FN2O2S — CID 174419300
3-[(4-fluoro-N-sulfinoanilino)methyl]pyridine (PubChem CID 174419300) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[(4-fluoro-N-sulfinoanilino)methyl]pyridine.
| Compound Name | 3-[(4-fluoro-N-sulfinoanilino)methyl]pyridine |
|---|---|
| PubChem CID | 174419300 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-[(4-fluoro-N-sulfinoanilino)methyl]pyridine |
| SMILES | O=S(O)N(Cc1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FN2O2S/c13-11-3-5-12(6-4-11)15(18(16)17)9-10-2-1-7-14-8-10/h1-8H,9H2,(H,16,17) |
| InChIKey | HGDAAAQPLBZEGO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|