C17H18FN3O — CID 71938987
N-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 71938987) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71938987 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(N1CCCC1)N(Cc1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O/c18-15-5-7-16(8-6-15)21(13-14-4-3-9-19-12-14)17(22)20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2 |
| InChIKey | AVVAXDOXFOSLAY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |