C19H21FN2O3 — CID 95625827
N-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 95625827) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95625827 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methoxy]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(COC[C@H]1CCCO1)N(Cc1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O3/c20-16-5-7-17(8-6-16)22(12-15-3-1-9-21-11-15)19(23)14-24-13-18-4-2-10-25-18/h1,3,5-9,11,18H,2,4,10,12-14H2/t18-/m1/s1 |
| InChIKey | TXXUYGNJBMVQER-GOSISDBHSA-N |
| XLogP | 2.95 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |