C23H23FN4O3 — CID 55835045
3-[6-(4-fluorophenoxy)-3-pyridinyl]-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 55835045) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-[6-(4-fluorophenoxy)-3-pyridinyl]-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 3-[6-(4-fluorophenoxy)-3-pyridinyl]-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 55835045 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[6-(4-fluorophenoxy)-3-pyridinyl]-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)nc1)N(Cc1cccnc1)CC1CCCO1 |
| InChI | InChI=1S/C23H23FN4O3/c24-18-5-8-20(9-6-18)31-22-10-7-19(14-26-22)27-23(29)28(16-21-4-2-12-30-21)15-17-3-1-11-25-13-17/h1,3,5-11,13-14,21H,2,4,12,15-16H2,(H,27,29) |
| InChIKey | WXFMNOBTFAQMHV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |