C19H22ClN3O3 — CID 55833254
3-(3-chloro-4-methoxyphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 55833254) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 55833254 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-1-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2cccnc2)CC2CCCO2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O3/c1-25-18-7-6-15(10-17(18)20)22-19(24)23(13-16-5-3-9-26-16)12-14-4-2-8-21-11-14/h2,4,6-8,10-11,16H,3,5,9,12-13H2,1H3,(H,22,24) |
| InChIKey | JBISABPWOIPSAF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |