C22H26N4O3 — CID 55834532
N-cyclopropyl-3-[[oxolan-2-ylmethyl(pyridin-3-ylmethyl)carbamoyl]amino]benzamide (PubChem CID 55834532) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-cyclopropyl-3-[[oxolan-2-ylmethyl(pyridin-3-ylmethyl)carbamoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[oxolan-2-ylmethyl(pyridin-3-ylmethyl)carbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 55834532 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-cyclopropyl-3-[[oxolan-2-ylmethyl(pyridin-3-ylmethyl)carbamoyl]amino]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(NC(=O)N(Cc2cccnc2)CC2CCCO2)c1 |
| InChI | InChI=1S/C22H26N4O3/c27-21(24-18-8-9-18)17-5-1-6-19(12-17)25-22(28)26(15-20-7-3-11-29-20)14-16-4-2-10-23-13-16/h1-2,4-6,10,12-13,18,20H,3,7-9,11,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | PDDVVWUNMLQTPO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |