C24H31FN4O3 — CID 52504290
3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)urea (PubChem CID 52504290) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 52504290 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-1-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)urea |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)N(Cc3cccnc3)C[C@@H]3CCCO3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C24H31FN4O3/c1-17-13-28(14-18(2)32-17)23-8-7-20(11-22(23)25)27-24(30)29(16-21-6-4-10-31-21)15-19-5-3-9-26-12-19/h3,5,7-9,11-12,17-18,21H,4,6,10,13-16H2,1-2H3,(H,27,30)/t17-,18+,21-/m0/s1 |
| InChIKey | XKESFJMTYGBTKX-UEXGIBASSA-N |
| XLogP | 4.05 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|