C14H22N4O — CID 79160812
N-(3-aminopropyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 79160812) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-aminopropyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79160812 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-(3-aminopropyl)-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | NCCCN(Cc1cccnc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H22N4O/c15-6-4-10-18(12-13-5-3-7-16-11-13)14(19)17-8-1-2-9-17/h3,5,7,11H,1-2,4,6,8-10,12,15H2 |
| InChIKey | CJXTXEYHOVABKV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |