C14H24N4O — CID 79153559
1-(3-aminopropyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea (PubChem CID 79153559) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-(3-aminopropyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 79153559 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-(3-aminopropyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea |
| SMILES | CCN(CC)C(=O)N(CCCN)Cc1cccnc1 |
| InChI | InChI=1S/C14H24N4O/c1-3-17(4-2)14(19)18(10-6-8-15)12-13-7-5-9-16-11-13/h5,7,9,11H,3-4,6,8,10,12,15H2,1-2H3 |
| InChIKey | SGRWGMCRYTYHFV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |