C19H25N3O — CID 110360929
1-(3,4-dimethylphenyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea (PubChem CID 110360929) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 110360929 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3,3-diethyl-1-(pyridin-3-ylmethyl)urea |
| SMILES | CCN(CC)C(=O)N(Cc1cccnc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H25N3O/c1-5-21(6-2)19(23)22(14-17-8-7-11-20-13-17)18-10-9-15(3)16(4)12-18/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | AABQYZNQKFFGML-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |