C20H20N2O2S — CID 110360936
N-(3,4-dimethylphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 110360936) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110360936 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(Cc2cccnc2)S(=O)(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C20H20N2O2S/c1-16-10-11-19(13-17(16)2)22(15-18-7-6-12-21-14-18)25(23,24)20-8-4-3-5-9-20/h3-14H,15H2,1-2H3 |
| InChIKey | RBSYVDXCQRYGTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |