C21H21NO2S — CID 126386470
N-benzyl-N-(3,5-dimethylphenyl)benzenesulfonamide (PubChem CID 126386470) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-benzyl-N-(3,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-(3,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126386470 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-benzyl-N-(3,5-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)cc(N(Cc2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H21NO2S/c1-17-13-18(2)15-20(14-17)22(16-19-9-5-3-6-10-19)25(23,24)21-11-7-4-8-12-21/h3-15H,16H2,1-2H3 |
| InChIKey | ONTZEPHCLVBZCX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |