C20H18BrNO2S — CID 46022840
N-benzyl-N-(4-bromophenyl)-3-methylbenzenesulfonamide (PubChem CID 46022840) has the molecular formula C20H18BrNO2S and a molecular weight of 416.34 g/mol. Its IUPAC name is N-benzyl-N-(4-bromophenyl)-3-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-(4-bromophenyl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46022840 |
| Molecular Formula | C20H18BrNO2S |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | N-benzyl-N-(4-bromophenyl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(Cc2ccccc2)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H18BrNO2S/c1-16-6-5-9-20(14-16)25(23,24)22(15-17-7-3-2-4-8-17)19-12-10-18(21)11-13-19/h2-14H,15H2,1H3 |
| InChIKey | LHEGTDZWJYLMAR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |