C21H20BrNO3S — CID 46022175
N-(4-bromophenyl)-N-[(3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 46022175) has the molecular formula C21H20BrNO3S and a molecular weight of 446.37 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(4-bromophenyl)-N-[(3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46022175 |
| Molecular Formula | C21H20BrNO3S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | N-(4-bromophenyl)-N-[(3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cccc(CN(c2ccc(Br)cc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H20BrNO3S/c1-16-6-12-21(13-7-16)27(24,25)23(19-10-8-18(22)9-11-19)15-17-4-3-5-20(14-17)26-2/h3-14H,15H2,1-2H3 |
| InChIKey | NSHORBBRONGSHL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |