C21H19BrFNO3S — CID 46023288
N-(4-bromophenyl)-4-fluoro-N-[(3-methoxyphenyl)methyl]-2-methylbenzenesulfonamide (PubChem CID 46023288) has the molecular formula C21H19BrFNO3S and a molecular weight of 464.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-fluoro-N-[(3-methoxyphenyl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(4-bromophenyl)-4-fluoro-N-[(3-methoxyphenyl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46023288 |
| Molecular Formula | C21H19BrFNO3S |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | N-(4-bromophenyl)-4-fluoro-N-[(3-methoxyphenyl)methyl]-2-methylbenzenesulfonamide |
| SMILES | COc1cccc(CN(c2ccc(Br)cc2)S(=O)(=O)c2ccc(F)cc2C)c1 |
| InChI | InChI=1S/C21H19BrFNO3S/c1-15-12-18(23)8-11-21(15)28(25,26)24(19-9-6-17(22)7-10-19)14-16-4-3-5-20(13-16)27-2/h3-13H,14H2,1-2H3 |
| InChIKey | YORMAHILDYPTMH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |