C20H17F2NO2S — CID 46152667
N-(4-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-methylbenzenesulfonamide (PubChem CID 46152667) has the molecular formula C20H17F2NO2S and a molecular weight of 373.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(4-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46152667 |
| Molecular Formula | C20H17F2NO2S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-(4-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)N(Cc1cccc(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F2NO2S/c1-15-5-2-3-8-20(15)26(24,25)23(19-11-9-17(21)10-12-19)14-16-6-4-7-18(22)13-16/h2-13H,14H2,1H3 |
| InChIKey | AQFQCVGZBOQTNY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |