C17H20FN3O — CID 110360744
1,1-diethyl-3-(3-fluorophenyl)-3-(pyridin-3-ylmethyl)urea (PubChem CID 110360744) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is 1,1-diethyl-3-(3-fluorophenyl)-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1,1-diethyl-3-(3-fluorophenyl)-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 110360744 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1,1-diethyl-3-(3-fluorophenyl)-3-(pyridin-3-ylmethyl)urea |
| SMILES | CCN(CC)C(=O)N(Cc1cccnc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H20FN3O/c1-3-20(4-2)17(22)21(13-14-7-6-10-19-12-14)16-9-5-8-15(18)11-16/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | MLMBBFDGEZUANA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |