C21H19FN2O3 — CID 110360716
N-(3-fluorophenyl)-3,5-dimethoxy-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 110360716) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3,5-dimethoxy-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(3-fluorophenyl)-3,5-dimethoxy-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110360716 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(3-fluorophenyl)-3,5-dimethoxy-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(Cc2cccnc2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H19FN2O3/c1-26-19-9-16(10-20(12-19)27-2)21(25)24(14-15-5-4-8-23-13-15)18-7-3-6-17(22)11-18/h3-13H,14H2,1-2H3 |
| InChIKey | JYUHGUFXTBVOQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |