C12H21N3 — CID 63264719
N'-ethyl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine (PubChem CID 63264719) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-ethyl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 63264719 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-ethyl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine |
| SMILES | CCN(CCCN)CCc1cccnc1 |
| InChI | InChI=1S/C12H21N3/c1-2-15(9-4-7-13)10-6-12-5-3-8-14-11-12/h3,5,8,11H,2,4,6-7,9-10,13H2,1H3 |
| InChIKey | GUBITUYRCFFAMH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |