C12H21N3 — CID 63265157
N'-propyl-N'-(2-pyridin-3-ylethyl)ethane-1,2-diamine (PubChem CID 63265157) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-propyl-N'-(2-pyridin-3-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-propyl-N'-(2-pyridin-3-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63265157 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-propyl-N'-(2-pyridin-3-ylethyl)ethane-1,2-diamine |
| SMILES | CCCN(CCN)CCc1cccnc1 |
| InChI | InChI=1S/C12H21N3/c1-2-8-15(10-6-13)9-5-12-4-3-7-14-11-12/h3-4,7,11H,2,5-6,8-10,13H2,1H3 |
| InChIKey | GNCROMGKKNJYRS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |