C12H20N2 — CID 121009449
N,N-diethyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 121009449) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N,N-diethyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | N,N-diethyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 121009449 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,N-diethyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CCN(CC)CCCc1cccnc1 |
| InChI | InChI=1S/C12H20N2/c1-3-14(4-2)10-6-8-12-7-5-9-13-11-12/h5,7,9,11H,3-4,6,8,10H2,1-2H3 |
| InChIKey | KVNDDASOLCLRSO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |