C19H21F2N3O2S — CID 70727755
(4aR,7aS)-4-[(2,4-difluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70727755) has the molecular formula C19H21F2N3O2S and a molecular weight of 393.46 g/mol. Its IUPAC name is (4aR,7aS)-4-[(2,4-difluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(2,4-difluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70727755 |
| Molecular Formula | C19H21F2N3O2S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (4aR,7aS)-4-[(2,4-difluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@H](C1)N(Cc1ccc(F)cc1F)CCN2Cc1cccnc1 |
| InChI | InChI=1S/C19H21F2N3O2S/c20-16-4-3-15(17(21)8-16)11-24-7-6-23(10-14-2-1-5-22-9-14)18-12-27(25,26)13-19(18)24/h1-5,8-9,18-19H,6-7,10-13H2/t18-,19+/m1/s1 |
| InChIKey | LBIUPFDSAAISSZ-MOPGFXCFSA-N |
| XLogP | 1.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |