C16H23FN2O4S — CID 72904864
2-[(4aR,7aS)-4-[(2-fluoro-4-methoxyphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol (PubChem CID 72904864) has the molecular formula C16H23FN2O4S and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[(4aR,7aS)-4-[(2-fluoro-4-methoxyphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol.
| Compound Name | 2-[(4aR,7aS)-4-[(2-fluoro-4-methoxyphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
|---|---|
| PubChem CID | 72904864 |
| Molecular Formula | C16H23FN2O4S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[(4aR,7aS)-4-[(2-fluoro-4-methoxyphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
| SMILES | COc1ccc(CN2CCN(CCO)[C@@H]3CS(=O)(=O)C[C@@H]32)c(F)c1 |
| InChI | InChI=1S/C16H23FN2O4S/c1-23-13-3-2-12(14(17)8-13)9-19-5-4-18(6-7-20)15-10-24(21,22)11-16(15)19/h2-3,8,15-16,20H,4-7,9-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | AMCGBFUTLVNJDI-CVEARBPZSA-N |
| XLogP | 0.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |