C16H24N2O3S — CID 70706171
(4aR,7aS)-4-[(4-methoxy-2-methylphenyl)methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70706171) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (4aR,7aS)-4-[(4-methoxy-2-methylphenyl)methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(4-methoxy-2-methylphenyl)methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70706171 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (4aR,7aS)-4-[(4-methoxy-2-methylphenyl)methyl]-1-methyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | COc1ccc(CN2CCN(C)[C@@H]3CS(=O)(=O)C[C@@H]32)c(C)c1 |
| InChI | InChI=1S/C16H24N2O3S/c1-12-8-14(21-3)5-4-13(12)9-18-7-6-17(2)15-10-22(19,20)11-16(15)18/h4-5,8,15-16H,6-7,9-11H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | IQDWVUZKDRKYQO-CVEARBPZSA-N |
| XLogP | 0.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |