C19H25N3O3S — CID 70766146
3-[[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 70766146) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-[[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70766146 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN3CCN(C)[C@@H]4CS(=O)(=O)C[C@@H]43)cc2c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-12-6-13(2)18-14(7-12)8-15(19(23)20-18)9-22-5-4-21(3)16-10-26(24,25)11-17(16)22/h6-8,16-17H,4-5,9-11H2,1-3H3,(H,20,23)/t16-,17+/m1/s1 |
| InChIKey | LQYCAFFYEUNCOR-SJORKVTESA-N |
| XLogP | 1.06 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |