C18H26FN3O3S — CID 133109873
2-[(4aR,7aS)-1-[(4-fluoro-2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide (PubChem CID 133109873) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(4aR,7aS)-1-[(4-fluoro-2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aS)-1-[(4-fluoro-2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133109873 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[(4aR,7aS)-1-[(4-fluoro-2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
| SMILES | Cc1cc(F)ccc1CN1CCN(CC(=O)N(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H26FN3O3S/c1-13-8-15(19)5-4-14(13)9-21-6-7-22(10-18(23)20(2)3)17-12-26(24,25)11-16(17)21/h4-5,8,16-17H,6-7,9-12H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | IERUWGBODFQJLD-SJORKVTESA-N |
| XLogP | 0.51 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |