C18H25FN2O3S — CID 70709124
1-[(4aS,7aR)-1-[(3-fluoro-2,4-dimethylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one (PubChem CID 70709124) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[(3-fluoro-2,4-dimethylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-[(3-fluoro-2,4-dimethylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 70709124 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[(4aS,7aR)-1-[(3-fluoro-2,4-dimethylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(Cc2ccc(C)c(F)c2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H25FN2O3S/c1-4-17(22)21-8-7-20(15-10-25(23,24)11-16(15)21)9-14-6-5-12(2)18(19)13(14)3/h5-6,15-16H,4,7-11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | SCFIWSLAUNWPDZ-JKSUJKDBSA-N |
| XLogP | 1.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |