C16H25N5O3S — CID 70759837
1-[(4aS,7aR)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one (PubChem CID 70759837) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 70759837 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[(4aS,7aR)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(Cc2cnc(N(C)C)nc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H25N5O3S/c1-4-15(22)21-6-5-20(13-10-25(23,24)11-14(13)21)9-12-7-17-16(18-8-12)19(2)3/h7-8,13-14H,4-6,9-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | NXARGLHVRMLPLE-UONOGXRCSA-N |
| XLogP | -0.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |