C16H27N5O2S — CID 70746615
5-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine (PubChem CID 70746615) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 5-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 70746615 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 5-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCCN1CCN(Cc2cnc(NCC)nc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H27N5O2S/c1-3-5-20-6-7-21(15-12-24(22,23)11-14(15)20)10-13-8-18-16(17-4-2)19-9-13/h8-9,14-15H,3-7,10-12H2,1-2H3,(H,17,18,19)/t14-,15+/m1/s1 |
| InChIKey | ZSMNPLUDPJPAIJ-CABCVRRESA-N |
| XLogP | 0.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |