C18H28N2O4S — CID 70776298
2-[2-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]phenoxy]ethanol (PubChem CID 70776298) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[2-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 70776298 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[2-[[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]phenoxy]ethanol |
| SMILES | CCCN1CCN(Cc2ccccc2OCCO)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H28N2O4S/c1-2-7-19-8-9-20(17-14-25(22,23)13-16(17)19)12-15-5-3-4-6-18(15)24-11-10-21/h3-6,16-17,21H,2,7-14H2,1H3/t16-,17+/m1/s1 |
| InChIKey | SLNTUVFLRHSEMZ-SJORKVTESA-N |
| XLogP | 0.75 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |