C15H21F3N4O3S — CID 133128074
1-[(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 133128074) has the molecular formula C15H21F3N4O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 133128074 |
| Molecular Formula | C15H21F3N4O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | Cc1[nH]cnc1CN1CCN(C(=O)CCC(F)(F)F)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H21F3N4O3S/c1-10-11(20-9-19-10)6-21-4-5-22(14(23)2-3-15(16,17)18)13-8-26(24,25)7-12(13)21/h9,12-13H,2-8H2,1H3,(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | QEIIMSPURRKRGD-QWHCGFSZSA-N |
| XLogP | 0.87 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |