C18H22N4O4S — CID 133125994
[(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-hydroxyphenyl)methanone (PubChem CID 133125994) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is [(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-hydroxyphenyl)methanone.
| Compound Name | [(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 133125994 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [(4aS,7aR)-1-[(5-methyl-1H-imidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-hydroxyphenyl)methanone |
| SMILES | Cc1[nH]cnc1CN1CCN(C(=O)c2cccc(O)c2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H22N4O4S/c1-12-15(20-11-19-12)8-21-5-6-22(17-10-27(25,26)9-16(17)21)18(24)13-3-2-4-14(23)7-13/h2-4,7,11,16-17,23H,5-6,8-10H2,1H3,(H,19,20)/t16-,17+/m0/s1 |
| InChIKey | AHEMXORLGIJKHQ-DLBZAZTESA-N |
| XLogP | 0.55 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |