C20H27FN2O3S — CID 78084480
2-(4-fluoro-3-methylphenyl)-1-[1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone (PubChem CID 78084480) has the molecular formula C20H27FN2O3S and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-1-[1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-1-[1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
|---|---|
| PubChem CID | 78084480 |
| Molecular Formula | C20H27FN2O3S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-1-[1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
| SMILES | CC(C)=CCN1CCN(C(=O)Cc2ccc(F)c(C)c2)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C20H27FN2O3S/c1-14(2)6-7-22-8-9-23(19-13-27(25,26)12-18(19)22)20(24)11-16-4-5-17(21)15(3)10-16/h4-6,10,18-19H,7-9,11-13H2,1-3H3 |
| InChIKey | XYCPXMGUHDMNGZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|